About 1H-isoquinolino[2,1-b]isoquinoline
1H-isoquinolino[2,1-b]isoquinoline (PubChem CID 19964382) has the molecular formula C17H13N
and a molecular weight of 231.30 g/mol. Its IUPAC name is 1H-isoquinolino[2,1-b]isoquinoline.
Molecular Properties
| Compound Name | 1H-isoquinolino[2,1-b]isoquinoline |
| PubChem CID | 19964382 |
| Molecular Formula | C17H13N |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1H-isoquinolino[2,1-b]isoquinoline |
| SMILES | C1=CCC2=C3C=c4ccccc4=CN3C=CC2=C1 |
| InChI | InChI=1S/C17H13N/c1-2-7-15-12-18-10-9-13-5-3-4-8-16(13)17(18)11-14(15)6-1/h1-7,9-12H,8H2 |
| InChIKey | RDLZSHBYBXGLNQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-isoquinolino[2,1-b]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-isoquinolino[2,1-b]isoquinoline?
The IUPAC name of 1H-isoquinolino[2,1-b]isoquinoline (CID 19964382) is 1H-isoquinolino[2,1-b]isoquinoline.
What is the SMILES notation for 1H-isoquinolino[2,1-b]isoquinoline?
The canonical SMILES for 1H-isoquinolino[2,1-b]isoquinoline is C1=CCC2=C3C=c4ccccc4=CN3C=CC2=C1.
What is the InChIKey of 1H-isoquinolino[2,1-b]isoquinoline?
The InChIKey is RDLZSHBYBXGLNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N/c1-2-7-15-12-18-10-9-13-5-3-4-8-16(13)17(18)11-14(15)6-1/h1-7,9-12H,8H2.
What are the key properties of 1H-isoquinolino[2,1-b]isoquinoline?
1H-isoquinolino[2,1-b]isoquinoline has a molecular weight of 231.30 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-isoquinolino[2,1-b]isoquinoline is sourced from PubChem (CID 19964382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).