About 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole
3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole (PubChem CID 19964642) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole.
Molecular Properties
| Compound Name | 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole |
| PubChem CID | 19964642 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole |
| SMILES | Cn1cnc2c1CCC2 |
| InChI | InChI=1S/C7H10N2/c1-9-5-8-6-3-2-4-7(6)9/h5H,2-4H2,1H3 |
| InChIKey | BLUUHKFIOWPMKS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole?
The IUPAC name of 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole (CID 19964642) is 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole.
What is the SMILES notation for 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole?
The canonical SMILES for 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole is Cn1cnc2c1CCC2.
What is the InChIKey of 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole?
The InChIKey is BLUUHKFIOWPMKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-9-5-8-6-3-2-4-7(6)9/h5H,2-4H2,1H3.
What are the key properties of 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole?
3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole has a molecular weight of 122.17 g/mol, XLogP of 0.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,6-dihydro-4H-cyclopenta[d]imidazole is sourced from PubChem (CID 19964642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).