About 4-methylimidazo[4,5-b]pyridine
4-methylimidazo[4,5-b]pyridine (PubChem CID 19964667) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 4-methylimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 4-methylimidazo[4,5-b]pyridine |
| PubChem CID | 19964667 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 4-methylimidazo[4,5-b]pyridine |
| SMILES | Cn1cccc2ncnc1-2 |
| InChI | InChI=1S/C7H7N3/c1-10-4-2-3-6-7(10)9-5-8-6/h2-5H,1H3 |
| InChIKey | HDGRUPSHIORBCY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylimidazo[4,5-b]pyridine?
The IUPAC name of 4-methylimidazo[4,5-b]pyridine (CID 19964667) is 4-methylimidazo[4,5-b]pyridine.
What is the SMILES notation for 4-methylimidazo[4,5-b]pyridine?
The canonical SMILES for 4-methylimidazo[4,5-b]pyridine is Cn1cccc2ncnc1-2.
What is the InChIKey of 4-methylimidazo[4,5-b]pyridine?
The InChIKey is HDGRUPSHIORBCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-10-4-2-3-6-7(10)9-5-8-6/h2-5H,1H3.
What are the key properties of 4-methylimidazo[4,5-b]pyridine?
4-methylimidazo[4,5-b]pyridine has a molecular weight of 133.15 g/mol, XLogP of 0.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylimidazo[4,5-b]pyridine is sourced from PubChem (CID 19964667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).