C33H30N8S — CID 19964984
2-[2-ethyl-7-methyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole (PubChem CID 19964984) has the molecular formula C33H30N8S and a molecular weight of 570.73 g/mol. Its IUPAC name is 2-[2-ethyl-7-methyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 2-[2-ethyl-7-methyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 19964984 |
| Molecular Formula | C33H30N8S |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 2-[2-ethyl-7-methyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole |
| SMILES | CCc1nc2c(C)cc(-c3cn4c5c(sc4n3)CCCC5)cc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C33H30N8S/c1-3-30-35-31-20(2)16-23(26-19-41-27-10-6-7-11-29(27)42-33(41)34-26)17-28(31)40(30)18-21-12-14-22(15-13-21)24-8-4-5-9-25(24)32-36-38-39-37-32/h4-5,8-9,12-17,19H,3,6-7,10-11,18H2,1-2H3,(H,36,37,38,39) |
| InChIKey | KCPOGWPJEVXCIS-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |