C26H32N4O5 — CID 19965273
4-[8-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]methyl]imidazo[1,2-a]pyridin-2-yl]benzoic acid (PubChem CID 19965273) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is 4-[8-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]methyl]imidazo[1,2-a]pyridin-2-yl]benzoic acid.
| Compound Name | 4-[8-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]methyl]imidazo[1,2-a]pyridin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 19965273 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 4-[8-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]methyl]imidazo[1,2-a]pyridin-2-yl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)NCc1cccn2cc(-c3ccc(C(=O)O)cc3)nc12 |
| InChI | InChI=1S/C26H32N4O5/c1-26(2,3)35-25(34)27-14-6-4-5-9-22(31)28-16-20-8-7-15-30-17-21(29-23(20)30)18-10-12-19(13-11-18)24(32)33/h7-8,10-13,15,17H,4-6,9,14,16H2,1-3H3,(H,27,34)(H,28,31)(H,32,33) |
| InChIKey | XAEQDLVTMGRACK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|