About benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate
benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate (PubChem CID 19965295) has the molecular formula C25H20N4O3
and a molecular weight of 424.46 g/mol. Its IUPAC name is benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate.
Molecular Properties
| Compound Name | benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate |
| PubChem CID | 19965295 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate |
| SMILES | N#Cc1cccn2cc(-c3ccc(C(=O)NCCC(=O)OCc4ccccc4)cc3)nc12 |
| InChI | InChI=1S/C25H20N4O3/c26-15-21-7-4-14-29-16-22(28-24(21)29)19-8-10-20(11-9-19)25(31)27-13-12-23(30)32-17-18-5-2-1-3-6-18/h1-11,14,16H,12-13,17H2,(H,27,31) |
| InChIKey | CVONERIAPXYBNM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate?
The IUPAC name of benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate (CID 19965295) is benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate.
What is the SMILES notation for benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate?
The canonical SMILES for benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate is N#Cc1cccn2cc(-c3ccc(C(=O)NCCC(=O)OCc4ccccc4)cc3)nc12.
What is the InChIKey of benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate?
The InChIKey is CVONERIAPXYBNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N4O3/c26-15-21-7-4-14-29-16-22(28-24(21)29)19-8-10-20(11-9-19)25(31)27-13-12-23(30)32-17-18-5-2-1-3-6-18/h1-11,14,16H,12-13,17H2,(H,27,31).
What are the key properties of benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate?
benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate has a molecular weight of 424.46 g/mol, XLogP of 3.74, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-[[4-(8-cyanoimidazo[1,2-a]pyridin-2-yl)benzoyl]amino]propanoate is sourced from PubChem (CID 19965295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).