About (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium
(5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium (PubChem CID 19965661) has the molecular formula C29H25NPS+
and a molecular weight of 450.57 g/mol. Its IUPAC name is (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium.
Molecular Properties
| Compound Name | (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium |
| PubChem CID | 19965661 |
| Molecular Formula | C29H25NPS+ |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium |
| SMILES | Cc1sc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C29H25NPS/c1-23-29(24-14-6-2-7-15-24)30-28(32-23)22-31(25-16-8-3-9-17-25,26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21H,22H2,1H3/q+1 |
| InChIKey | WYHCUESJUIBZOU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium?
The IUPAC name of (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium (CID 19965661) is (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium.
What is the SMILES notation for (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium?
The canonical SMILES for (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium is Cc1sc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium?
The InChIKey is WYHCUESJUIBZOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25NPS/c1-23-29(24-14-6-2-7-15-24)30-28(32-23)22-31(25-16-8-3-9-17-25,26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21H,22H2,1H3/q+1.
What are the key properties of (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium?
(5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium has a molecular weight of 450.57 g/mol, XLogP of 6.61, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl-triphenylphosphanium is sourced from PubChem (CID 19965661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).