About CID 19966540
CID 19966540 (PubChem CID 19966540) has the molecular formula C26H21O4Si
and a molecular weight of 425.54 g/mol.
Molecular Properties
| Compound Name | CID 19966540 |
| PubChem CID | 19966540 |
| Molecular Formula | C26H21O4Si |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | — |
| SMILES | [Si]C(Oc1ccccc1)(Oc1ccccc1)C(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C26H21O4Si/c31-26(29-23-17-9-3-10-18-23,30-24-19-11-4-12-20-24)25(27-21-13-5-1-6-14-21)28-22-15-7-2-8-16-22/h1-20,25H |
| InChIKey | NYJBPGWVADHIAE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 19966540 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19966540?
The IUPAC name of CID 19966540 (CID 19966540) is not available.
What is the SMILES notation for CID 19966540?
The canonical SMILES for CID 19966540 is [Si]C(Oc1ccccc1)(Oc1ccccc1)C(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of CID 19966540?
The InChIKey is NYJBPGWVADHIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21O4Si/c31-26(29-23-17-9-3-10-18-23,30-24-19-11-4-12-20-24)25(27-21-13-5-1-6-14-21)28-22-15-7-2-8-16-22/h1-20,25H.
What are the key properties of CID 19966540?
CID 19966540 has a molecular weight of 425.54 g/mol, XLogP of 5.45, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19966540 is sourced from PubChem (CID 19966540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).