About 5-isocyanato-1,2,3-trimethylbenzene
5-isocyanato-1,2,3-trimethylbenzene (PubChem CID 19966630) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 5-isocyanato-1,2,3-trimethylbenzene.
Molecular Properties
| Compound Name | 5-isocyanato-1,2,3-trimethylbenzene |
| PubChem CID | 19966630 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 5-isocyanato-1,2,3-trimethylbenzene |
| SMILES | Cc1cc(N=C=O)cc(C)c1C |
| InChI | InChI=1S/C10H11NO/c1-7-4-10(11-6-12)5-8(2)9(7)3/h4-5H,1-3H3 |
| InChIKey | QQNKCMRHDVWUIN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyanato-1,2,3-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyanato-1,2,3-trimethylbenzene?
The IUPAC name of 5-isocyanato-1,2,3-trimethylbenzene (CID 19966630) is 5-isocyanato-1,2,3-trimethylbenzene.
What is the SMILES notation for 5-isocyanato-1,2,3-trimethylbenzene?
The canonical SMILES for 5-isocyanato-1,2,3-trimethylbenzene is Cc1cc(N=C=O)cc(C)c1C.
What is the InChIKey of 5-isocyanato-1,2,3-trimethylbenzene?
The InChIKey is QQNKCMRHDVWUIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-7-4-10(11-6-12)5-8(2)9(7)3/h4-5H,1-3H3.
What are the key properties of 5-isocyanato-1,2,3-trimethylbenzene?
5-isocyanato-1,2,3-trimethylbenzene has a molecular weight of 161.20 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyanato-1,2,3-trimethylbenzene is sourced from PubChem (CID 19966630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).