About N,N'-bis(aziridin-1-yl)butane-1,4-diamine
N,N'-bis(aziridin-1-yl)butane-1,4-diamine (PubChem CID 19966835) has the molecular formula C8H18N4
and a molecular weight of 170.26 g/mol. Its IUPAC name is N,N'-bis(aziridin-1-yl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N,N'-bis(aziridin-1-yl)butane-1,4-diamine |
| PubChem CID | 19966835 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | N,N'-bis(aziridin-1-yl)butane-1,4-diamine |
| SMILES | C(CCNN1CC1)CNN1CC1 |
| InChI | InChI=1S/C8H18N4/c1(3-9-11-5-6-11)2-4-10-12-7-8-12/h9-10H,1-8H2 |
| InChIKey | MVVSDNOQXOTGCB-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 30.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(aziridin-1-yl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(aziridin-1-yl)butane-1,4-diamine?
The IUPAC name of N,N'-bis(aziridin-1-yl)butane-1,4-diamine (CID 19966835) is N,N'-bis(aziridin-1-yl)butane-1,4-diamine.
What is the SMILES notation for N,N'-bis(aziridin-1-yl)butane-1,4-diamine?
The canonical SMILES for N,N'-bis(aziridin-1-yl)butane-1,4-diamine is C(CCNN1CC1)CNN1CC1.
What is the InChIKey of N,N'-bis(aziridin-1-yl)butane-1,4-diamine?
The InChIKey is MVVSDNOQXOTGCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4/c1(3-9-11-5-6-11)2-4-10-12-7-8-12/h9-10H,1-8H2.
What are the key properties of N,N'-bis(aziridin-1-yl)butane-1,4-diamine?
N,N'-bis(aziridin-1-yl)butane-1,4-diamine has a molecular weight of 170.26 g/mol, XLogP of -0.59, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(aziridin-1-yl)butane-1,4-diamine is sourced from PubChem (CID 19966835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).