C17H11ClF4N4O — CID 19966959
4-(6-chloro-3-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine (PubChem CID 19966959) has the molecular formula C17H11ClF4N4O and a molecular weight of 398.75 g/mol. Its IUPAC name is 4-(6-chloro-3-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(6-chloro-3-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 19966959 |
| Molecular Formula | C17H11ClF4N4O |
| Molecular Weight | 398.75 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 4-(6-chloro-3-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
| SMILES | FC(F)C(F)(F)Oc1cccc(Nc2nccc(-c3ccc(Cl)nc3)n2)c1 |
| InChI | InChI=1S/C17H11ClF4N4O/c18-14-5-4-10(9-24-14)13-6-7-23-16(26-13)25-11-2-1-3-12(8-11)27-17(21,22)15(19)20/h1-9,15H,(H,23,25,26) |
| InChIKey | CUPLJIYTJPAKKJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.75 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|