C18H12ClF4N3O — CID 19966997
4-(4-chlorophenyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine (PubChem CID 19966997) has the molecular formula C18H12ClF4N3O and a molecular weight of 397.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 19966997 |
| Molecular Formula | C18H12ClF4N3O |
| Molecular Weight | 397.76 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
| SMILES | FC(F)C(F)(F)Oc1cccc(Nc2nccc(-c3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C18H12ClF4N3O/c19-12-6-4-11(5-7-12)15-8-9-24-17(26-15)25-13-2-1-3-14(10-13)27-18(22,23)16(20)21/h1-10,16H,(H,24,25,26) |
| InChIKey | YWEZKJXXUFLVIU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.76 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|