C26H30F4N6O — CID 19967026
1-N,1-N,4-N-trimethyl-4-N-[4-[2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrimidin-4-yl]-2-pyridinyl]cyclohexane-1,4-diamine (PubChem CID 19967026) has the molecular formula C26H30F4N6O and a molecular weight of 518.56 g/mol. Its IUPAC name is 1-N,1-N,4-N-trimethyl-4-N-[4-[2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrimidin-4-yl]-2-pyridinyl]cyclohexane-1,4-diamine.
| Compound Name | 1-N,1-N,4-N-trimethyl-4-N-[4-[2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrimidin-4-yl]-2-pyridinyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 19967026 |
| Molecular Formula | C26H30F4N6O |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 1-N,1-N,4-N-trimethyl-4-N-[4-[2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrimidin-4-yl]-2-pyridinyl]cyclohexane-1,4-diamine |
| SMILES | CN(C)C1CCC(N(C)c2cc(-c3ccnc(Nc4cccc(OC(F)(F)C(F)F)c4)n3)ccn2)CC1 |
| InChI | InChI=1S/C26H30F4N6O/c1-35(2)19-7-9-20(10-8-19)36(3)23-15-17(11-13-31-23)22-12-14-32-25(34-22)33-18-5-4-6-21(16-18)37-26(29,30)24(27)28/h4-6,11-16,19-20,24H,7-10H2,1-3H3,(H,32,33,34) |
| InChIKey | WSQWRBPWNZUXPH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|