C16H17NO3 — CID 19967333
N-[(7-methoxynaphthalen-1-yl)methoxy]cyclopropanecarboxamide (PubChem CID 19967333) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[(7-methoxynaphthalen-1-yl)methoxy]cyclopropanecarboxamide.
| Compound Name | N-[(7-methoxynaphthalen-1-yl)methoxy]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 19967333 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[(7-methoxynaphthalen-1-yl)methoxy]cyclopropanecarboxamide |
| SMILES | COc1ccc2cccc(CONC(=O)C3CC3)c2c1 |
| InChI | InChI=1S/C16H17NO3/c1-19-14-8-7-11-3-2-4-13(15(11)9-14)10-20-17-16(18)12-5-6-12/h2-4,7-9,12H,5-6,10H2,1H3,(H,17,18) |
| InChIKey | QSAKTICTURLPQJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|