C11H9F5O4 — CID 19967863
methyl 2-hydroxy-2-methyl-3-(2,3,4,5,6-pentafluorophenoxy)propanoate (PubChem CID 19967863) has the molecular formula C11H9F5O4 and a molecular weight of 300.18 g/mol. Its IUPAC name is methyl 2-hydroxy-2-methyl-3-(2,3,4,5,6-pentafluorophenoxy)propanoate.
| Compound Name | methyl 2-hydroxy-2-methyl-3-(2,3,4,5,6-pentafluorophenoxy)propanoate |
|---|---|
| PubChem CID | 19967863 |
| Molecular Formula | C11H9F5O4 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | methyl 2-hydroxy-2-methyl-3-(2,3,4,5,6-pentafluorophenoxy)propanoate |
| SMILES | COC(=O)C(C)(O)COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H9F5O4/c1-11(18,10(17)19-2)3-20-9-7(15)5(13)4(12)6(14)8(9)16/h18H,3H2,1-2H3 |
| InChIKey | IZXYSDFNUYGFSU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|