C19H16F17N — CID 19967895
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-N-(2-phenylpropan-2-yl)decan-1-amine (PubChem CID 19967895) has the molecular formula C19H16F17N and a molecular weight of 581.31 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-N-(2-phenylpropan-2-yl)decan-1-amine.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-N-(2-phenylpropan-2-yl)decan-1-amine |
|---|---|
| PubChem CID | 19967895 |
| Molecular Formula | C19H16F17N |
| Molecular Weight | 581.31 g/mol |
| Exact Mass | 581.10 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-N-(2-phenylpropan-2-yl)decan-1-amine |
| SMILES | CC(C)(NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H16F17N/c1-11(2,10-6-4-3-5-7-10)37-9-8-12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)36/h3-7,37H,8-9H2,1-2H3 |
| InChIKey | JGSZQTJDFFMSHM-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.31 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|