About 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine
2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine (PubChem CID 19968640) has the molecular formula C23H19F6NO
and a molecular weight of 439.40 g/mol. Its IUPAC name is 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine.
Molecular Properties
| Compound Name | 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine |
| PubChem CID | 19968640 |
| Molecular Formula | C23H19F6NO |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine |
| SMILES | NC(COCc1cccc(C(F)(F)F)c1C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19F6NO/c24-22(25,26)19-13-7-8-16(20(19)23(27,28)29)14-31-15-21(30,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-13H,14-15,30H2 |
| InChIKey | XSOKGTYOZOCNDR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine?
The IUPAC name of 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine (CID 19968640) is 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine.
What is the SMILES notation for 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine?
The canonical SMILES for 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine is NC(COCc1cccc(C(F)(F)F)c1C(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine?
The InChIKey is XSOKGTYOZOCNDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19F6NO/c24-22(25,26)19-13-7-8-16(20(19)23(27,28)29)14-31-15-21(30,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-13H,14-15,30H2.
What are the key properties of 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine?
2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine has a molecular weight of 439.40 g/mol, XLogP of 6.14, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,3-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylethanamine is sourced from PubChem (CID 19968640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).