About 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile
2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile (PubChem CID 19968642) has the molecular formula C19H16F6N2O
and a molecular weight of 402.34 g/mol. Its IUPAC name is 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile.
Molecular Properties
| Compound Name | 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile |
| PubChem CID | 19968642 |
| Molecular Formula | C19H16F6N2O |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile |
| SMILES | N#CCNC(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H16F6N2O/c20-18(21,22)15-8-13(9-16(10-15)19(23,24)25)11-28-12-17(27-7-6-26)14-4-2-1-3-5-14/h1-5,8-10,17,27H,7,11-12H2 |
| InChIKey | ROLNWOZJMSEVAR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile?
The IUPAC name of 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile (CID 19968642) is 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile.
What is the SMILES notation for 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile?
The canonical SMILES for 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile is N#CCNC(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1.
What is the InChIKey of 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile?
The InChIKey is ROLNWOZJMSEVAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F6N2O/c20-18(21,22)15-8-13(9-16(10-15)19(23,24)25)11-28-12-17(27-7-6-26)14-4-2-1-3-5-14/h1-5,8-10,17,27H,7,11-12H2.
What are the key properties of 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile?
2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile has a molecular weight of 402.34 g/mol, XLogP of 5.10, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]amino]acetonitrile is sourced from PubChem (CID 19968642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).