About 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid
2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid (PubChem CID 19968649) has the molecular formula C10H12FN3O5
and a molecular weight of 273.22 g/mol. Its IUPAC name is 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid.
Molecular Properties
| Compound Name | 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid |
| PubChem CID | 19968649 |
| Molecular Formula | C10H12FN3O5 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid |
| SMILES | CC(=O)CNC(C)(C(=O)O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12FN3O5/c1-5(15)3-12-10(2,8(17)18)14-4-6(11)7(16)13-9(14)19/h4,12H,3H2,1-2H3,(H,17,18)(H,13,16,19) |
| InChIKey | GXPJVUZBBDPKQB-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid?
The IUPAC name of 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid (CID 19968649) is 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid.
What is the SMILES notation for 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid?
The canonical SMILES for 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid is CC(=O)CNC(C)(C(=O)O)n1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid?
The InChIKey is GXPJVUZBBDPKQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FN3O5/c1-5(15)3-12-10(2,8(17)18)14-4-6(11)7(16)13-9(14)19/h4,12H,3H2,1-2H3,(H,17,18)(H,13,16,19).
What are the key properties of 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid?
2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid has a molecular weight of 273.22 g/mol, XLogP of -1.39, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(2-oxopropylamino)propanoic acid is sourced from PubChem (CID 19968649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).