C62H44N4O4 — CID 19968810
2-[4-[3,5,7-tris[4-(1,3-benzoxazol-2-yl)phenyl]-1-adamantyl]phenyl]-1,3-benzoxazole (PubChem CID 19968810) has the molecular formula C62H44N4O4 and a molecular weight of 909.06 g/mol. Its IUPAC name is 2-[4-[3,5,7-tris[4-(1,3-benzoxazol-2-yl)phenyl]-1-adamantyl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[3,5,7-tris[4-(1,3-benzoxazol-2-yl)phenyl]-1-adamantyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 19968810 |
| Molecular Formula | C62H44N4O4 |
| Molecular Weight | 909.06 g/mol |
| Exact Mass | 908.34 |
| IUPAC Name | 2-[4-[3,5,7-tris[4-(1,3-benzoxazol-2-yl)phenyl]-1-adamantyl]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3ccc(C45CC6(c7ccc(-c8nc9ccccc9o8)cc7)CC(c7ccc(-c8nc9ccccc9o8)cc7)(C4)CC(c4ccc(-c7nc8ccccc8o7)cc4)(C5)C6)cc3)nc2c1 |
| InChI | InChI=1S/C62H44N4O4/c1-5-13-51-47(9-1)63-55(67-51)39-17-25-43(26-18-39)59-33-60(44-27-19-40(20-28-44)56-64-48-10-2-6-14-52(48)68-56)36-61(34-59,45-29-21-41(22-30-45)57-65-49-11-3-7-15-53(49)69-57)38-62(35-59,37-60)46-31-23-42(24-32-46)58-66-50-12-4-8-16-54(50)70-58/h1-32H,33-38H2 |
| InChIKey | MZVCVRPVNJYVKK-UHFFFAOYSA-N |
| XLogP | 15.35 |
| TPSA | 104.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.06 |
| LogP ≤ 5 | 15.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |