About 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine
1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine (PubChem CID 19969141) has the molecular formula C8H17N3
and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine |
| PubChem CID | 19969141 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine |
| SMILES | CCN=C=NC(CC)N(C)C |
| InChI | InChI=1S/C8H17N3/c1-5-8(11(3)4)10-7-9-6-2/h8H,5-6H2,1-4H3 |
| InChIKey | UGYPXRGQGNLWOF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine?
The IUPAC name of 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine (CID 19969141) is 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine is CCN=C=NC(CC)N(C)C.
What is the InChIKey of 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine?
The InChIKey is UGYPXRGQGNLWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3/c1-5-8(11(3)4)10-7-9-6-2/h8H,5-6H2,1-4H3.
What are the key properties of 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine?
1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine has a molecular weight of 155.24 g/mol, XLogP of 1.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 19969141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).