About 3-ethyl-2H-1,3-benzoxazole
3-ethyl-2H-1,3-benzoxazole (PubChem CID 19969378) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-ethyl-2H-1,3-benzoxazole.
Molecular Properties
| Compound Name | 3-ethyl-2H-1,3-benzoxazole |
| PubChem CID | 19969378 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3-ethyl-2H-1,3-benzoxazole |
| SMILES | CCN1COc2ccccc21 |
| InChI | InChI=1S/C9H11NO/c1-2-10-7-11-9-6-4-3-5-8(9)10/h3-6H,2,7H2,1H3 |
| InChIKey | QVPNVWIHUOTMSS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-2H-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2H-1,3-benzoxazole?
The IUPAC name of 3-ethyl-2H-1,3-benzoxazole (CID 19969378) is 3-ethyl-2H-1,3-benzoxazole.
What is the SMILES notation for 3-ethyl-2H-1,3-benzoxazole?
The canonical SMILES for 3-ethyl-2H-1,3-benzoxazole is CCN1COc2ccccc21.
What is the InChIKey of 3-ethyl-2H-1,3-benzoxazole?
The InChIKey is QVPNVWIHUOTMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-2-10-7-11-9-6-4-3-5-8(9)10/h3-6H,2,7H2,1H3.
What are the key properties of 3-ethyl-2H-1,3-benzoxazole?
3-ethyl-2H-1,3-benzoxazole has a molecular weight of 149.19 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2H-1,3-benzoxazole is sourced from PubChem (CID 19969378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).