C20H21F2N3O4 — CID 19969821
1-cyclopropyl-7-(1,6-dimethyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-c][1,2]oxazol-5-yl)-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 19969821) has the molecular formula C20H21F2N3O4 and a molecular weight of 405.40 g/mol. Its IUPAC name is 1-cyclopropyl-7-(1,6-dimethyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-c][1,2]oxazol-5-yl)-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7-(1,6-dimethyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-c][1,2]oxazol-5-yl)-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19969821 |
| Molecular Formula | C20H21F2N3O4 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-cyclopropyl-7-(1,6-dimethyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-c][1,2]oxazol-5-yl)-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CC1C2C(CON2C)CN1c1c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c2c1F |
| InChI | InChI=1S/C20H21F2N3O4/c1-9-16-10(8-29-23(16)2)6-24(9)18-14(21)5-12-17(15(18)22)25(11-3-4-11)7-13(19(12)26)20(27)28/h5,7,9-11,16H,3-4,6,8H2,1-2H3,(H,27,28) |
| InChIKey | GBDDRWKUYZPKBL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |