About 4-methoxy-N,5-dimethylpyrrolidin-3-amine
4-methoxy-N,5-dimethylpyrrolidin-3-amine (PubChem CID 19969876) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is 4-methoxy-N,5-dimethylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | 4-methoxy-N,5-dimethylpyrrolidin-3-amine |
| PubChem CID | 19969876 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 4-methoxy-N,5-dimethylpyrrolidin-3-amine |
| SMILES | CNC1CNC(C)C1OC |
| InChI | InChI=1S/C7H16N2O/c1-5-7(10-3)6(8-2)4-9-5/h5-9H,4H2,1-3H3 |
| InChIKey | RZUYSJKTFQCVEA-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-N,5-dimethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N,5-dimethylpyrrolidin-3-amine?
The IUPAC name of 4-methoxy-N,5-dimethylpyrrolidin-3-amine (CID 19969876) is 4-methoxy-N,5-dimethylpyrrolidin-3-amine.
What is the SMILES notation for 4-methoxy-N,5-dimethylpyrrolidin-3-amine?
The canonical SMILES for 4-methoxy-N,5-dimethylpyrrolidin-3-amine is CNC1CNC(C)C1OC.
What is the InChIKey of 4-methoxy-N,5-dimethylpyrrolidin-3-amine?
The InChIKey is RZUYSJKTFQCVEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O/c1-5-7(10-3)6(8-2)4-9-5/h5-9H,4H2,1-3H3.
What are the key properties of 4-methoxy-N,5-dimethylpyrrolidin-3-amine?
4-methoxy-N,5-dimethylpyrrolidin-3-amine has a molecular weight of 144.22 g/mol, XLogP of -0.42, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N,5-dimethylpyrrolidin-3-amine is sourced from PubChem (CID 19969876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).