About 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one
3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one (PubChem CID 19970012) has the molecular formula C23H24N2O
and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one |
| PubChem CID | 19970012 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1CN1CC=C(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H24N2O/c26-23-21(16-20-8-4-5-9-22(20)24-23)17-25-14-12-19(13-15-25)11-10-18-6-2-1-3-7-18/h1-9,12,16H,10-11,13-15,17H2,(H,24,26) |
| InChIKey | JUOQGFSZZWKOTG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one?
The IUPAC name of 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one (CID 19970012) is 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one.
What is the SMILES notation for 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one?
The canonical SMILES for 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one is O=c1[nH]c2ccccc2cc1CN1CC=C(CCc2ccccc2)CC1.
What is the InChIKey of 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one?
The InChIKey is JUOQGFSZZWKOTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O/c26-23-21(16-20-8-4-5-9-22(20)24-23)17-25-14-12-19(13-15-25)11-10-18-6-2-1-3-7-18/h1-9,12,16H,10-11,13-15,17H2,(H,24,26).
What are the key properties of 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one?
3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one has a molecular weight of 344.46 g/mol, XLogP of 4.29, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2-phenylethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1H-quinolin-2-one is sourced from PubChem (CID 19970012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).