C25H27F6NO4S — CID 19970133
2-[1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(3,4-dimethylphenyl)pyrrolidin-3-yl]ethyl methanesulfonate (PubChem CID 19970133) has the molecular formula C25H27F6NO4S and a molecular weight of 551.55 g/mol. Its IUPAC name is 2-[1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(3,4-dimethylphenyl)pyrrolidin-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(3,4-dimethylphenyl)pyrrolidin-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 19970133 |
| Molecular Formula | C25H27F6NO4S |
| Molecular Weight | 551.55 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | 2-[1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(3,4-dimethylphenyl)pyrrolidin-3-yl]ethyl methanesulfonate |
| SMILES | Cc1ccc(C2(CCOS(C)(=O)=O)CCN(C(=O)Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)C2)cc1C |
| InChI | InChI=1S/C25H27F6NO4S/c1-16-4-5-19(10-17(16)2)23(7-9-36-37(3,34)35)6-8-32(15-23)22(33)13-18-11-20(24(26,27)28)14-21(12-18)25(29,30)31/h4-5,10-12,14H,6-9,13,15H2,1-3H3 |
| InChIKey | KZRDQHHKDDJUCD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|