C27H30N2O — CID 19970196
3-(1-benzylpiperidin-4-yl)-2,2-diphenylpropanamide (PubChem CID 19970196) has the molecular formula C27H30N2O and a molecular weight of 398.55 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-4-yl)-2,2-diphenylpropanamide.
| Compound Name | 3-(1-benzylpiperidin-4-yl)-2,2-diphenylpropanamide |
|---|---|
| PubChem CID | 19970196 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 3-(1-benzylpiperidin-4-yl)-2,2-diphenylpropanamide |
| SMILES | NC(=O)C(CC1CCN(Cc2ccccc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O/c28-26(30)27(24-12-6-2-7-13-24,25-14-8-3-9-15-25)20-22-16-18-29(19-17-22)21-23-10-4-1-5-11-23/h1-15,22H,16-21H2,(H2,28,30) |
| InChIKey | MJEMPNKQWMYRSS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |