C17H23N5 — CID 19970906
N-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methyl]-1-methylimidazol-2-amine (PubChem CID 19970906) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is N-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methyl]-1-methylimidazol-2-amine.
| Compound Name | N-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methyl]-1-methylimidazol-2-amine |
|---|---|
| PubChem CID | 19970906 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | N-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methyl]-1-methylimidazol-2-amine |
| SMILES | CN(C)CCc1c[nH]c2ccc(CNc3nccn3C)cc12 |
| InChI | InChI=1S/C17H23N5/c1-21(2)8-6-14-12-19-16-5-4-13(10-15(14)16)11-20-17-18-7-9-22(17)3/h4-5,7,9-10,12,19H,6,8,11H2,1-3H3,(H,18,20) |
| InChIKey | PBLPNBLAUGXXQI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 48.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |