About 4-(2,4-diaminophenoxy)phenol
4-(2,4-diaminophenoxy)phenol (PubChem CID 19971372) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-(2,4-diaminophenoxy)phenol.
Molecular Properties
| Compound Name | 4-(2,4-diaminophenoxy)phenol |
| PubChem CID | 19971372 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4-(2,4-diaminophenoxy)phenol |
| SMILES | Nc1ccc(Oc2ccc(O)cc2)c(N)c1 |
| InChI | InChI=1S/C12H12N2O2/c13-8-1-6-12(11(14)7-8)16-10-4-2-9(15)3-5-10/h1-7,15H,13-14H2 |
| InChIKey | HRZCEYYSMPXIPG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-diaminophenoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-diaminophenoxy)phenol?
The IUPAC name of 4-(2,4-diaminophenoxy)phenol (CID 19971372) is 4-(2,4-diaminophenoxy)phenol.
What is the SMILES notation for 4-(2,4-diaminophenoxy)phenol?
The canonical SMILES for 4-(2,4-diaminophenoxy)phenol is Nc1ccc(Oc2ccc(O)cc2)c(N)c1.
What is the InChIKey of 4-(2,4-diaminophenoxy)phenol?
The InChIKey is HRZCEYYSMPXIPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c13-8-1-6-12(11(14)7-8)16-10-4-2-9(15)3-5-10/h1-7,15H,13-14H2.
What are the key properties of 4-(2,4-diaminophenoxy)phenol?
4-(2,4-diaminophenoxy)phenol has a molecular weight of 216.24 g/mol, XLogP of 2.35, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-diaminophenoxy)phenol is sourced from PubChem (CID 19971372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).