About N,N-dichloro-1,3-benzothiazol-7-amine
N,N-dichloro-1,3-benzothiazol-7-amine (PubChem CID 19971386) has the molecular formula C7H4Cl2N2S
and a molecular weight of 219.10 g/mol. Its IUPAC name is N,N-dichloro-1,3-benzothiazol-7-amine.
Molecular Properties
| Compound Name | N,N-dichloro-1,3-benzothiazol-7-amine |
| PubChem CID | 19971386 |
| Molecular Formula | C7H4Cl2N2S |
| Molecular Weight | 219.10 g/mol |
| Exact Mass | 217.95 |
| IUPAC Name | N,N-dichloro-1,3-benzothiazol-7-amine |
| SMILES | ClN(Cl)c1cccc2ncsc12 |
| InChI | InChI=1S/C7H4Cl2N2S/c8-11(9)6-3-1-2-5-7(6)12-4-10-5/h1-4H |
| InChIKey | CRVIXBXHZBMSTF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.10 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N-dichloro-1,3-benzothiazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dichloro-1,3-benzothiazol-7-amine?
The IUPAC name of N,N-dichloro-1,3-benzothiazol-7-amine (CID 19971386) is N,N-dichloro-1,3-benzothiazol-7-amine.
What is the SMILES notation for N,N-dichloro-1,3-benzothiazol-7-amine?
The canonical SMILES for N,N-dichloro-1,3-benzothiazol-7-amine is ClN(Cl)c1cccc2ncsc12.
What is the InChIKey of N,N-dichloro-1,3-benzothiazol-7-amine?
The InChIKey is CRVIXBXHZBMSTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2N2S/c8-11(9)6-3-1-2-5-7(6)12-4-10-5/h1-4H.
What are the key properties of N,N-dichloro-1,3-benzothiazol-7-amine?
N,N-dichloro-1,3-benzothiazol-7-amine has a molecular weight of 219.10 g/mol, XLogP of 3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dichloro-1,3-benzothiazol-7-amine is sourced from PubChem (CID 19971386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).