About CID 19971834
CID 19971834 (PubChem CID 19971834) has the molecular formula C24H34OSi
and a molecular weight of 366.62 g/mol.
Molecular Properties
| Compound Name | CID 19971834 |
| PubChem CID | 19971834 |
| Molecular Formula | C24H34OSi |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | — |
| SMILES | Cc1cccc([Si]CCc2cc(C(C)(C)C)c(O)cc2C(C)(C)C)c1C |
| InChI | InChI=1S/C24H34OSi/c1-16-10-9-11-22(17(16)2)26-13-12-18-14-20(24(6,7)8)21(25)15-19(18)23(3,4)5/h9-11,14-15,25H,12-13H2,1-8H3 |
| InChIKey | QKOVGYZICBEEKF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19971834 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19971834?
The IUPAC name of CID 19971834 (CID 19971834) is not available.
What is the SMILES notation for CID 19971834?
The canonical SMILES for CID 19971834 is Cc1cccc([Si]CCc2cc(C(C)(C)C)c(O)cc2C(C)(C)C)c1C.
What is the InChIKey of CID 19971834?
The InChIKey is QKOVGYZICBEEKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34OSi/c1-16-10-9-11-22(17(16)2)26-13-12-18-14-20(24(6,7)8)21(25)15-19(18)23(3,4)5/h9-11,14-15,25H,12-13H2,1-8H3.
What are the key properties of CID 19971834?
CID 19971834 has a molecular weight of 366.62 g/mol, XLogP of 5.59, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19971834 is sourced from PubChem (CID 19971834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).