About 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one
8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one (PubChem CID 19972595) has the molecular formula C22H24O4
and a molecular weight of 352.43 g/mol. Its IUPAC name is 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one.
Molecular Properties
| Compound Name | 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one |
| PubChem CID | 19972595 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one |
| SMILES | COC(CCCc1cccc2c(=O)c(C)c(-c3ccccc3)oc12)OC |
| InChI | InChI=1S/C22H24O4/c1-15-20(23)18-13-7-11-17(12-8-14-19(24-2)25-3)22(18)26-21(15)16-9-5-4-6-10-16/h4-7,9-11,13,19H,8,12,14H2,1-3H3 |
| InChIKey | JRBYQSOISKCWIQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one?
The IUPAC name of 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one (CID 19972595) is 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one.
What is the SMILES notation for 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one?
The canonical SMILES for 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one is COC(CCCc1cccc2c(=O)c(C)c(-c3ccccc3)oc12)OC.
What is the InChIKey of 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one?
The InChIKey is JRBYQSOISKCWIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24O4/c1-15-20(23)18-13-7-11-17(12-8-14-19(24-2)25-3)22(18)26-21(15)16-9-5-4-6-10-16/h4-7,9-11,13,19H,8,12,14H2,1-3H3.
What are the key properties of 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one?
8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one has a molecular weight of 352.43 g/mol, XLogP of 4.71, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4,4-dimethoxybutyl)-3-methyl-2-phenylchromen-4-one is sourced from PubChem (CID 19972595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).