About [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea
[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea (PubChem CID 19973131) has the molecular formula C16H17F4N3O3
and a molecular weight of 375.32 g/mol. Its IUPAC name is [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea.
Molecular Properties
| Compound Name | [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea |
| PubChem CID | 19973131 |
| Molecular Formula | C16H17F4N3O3 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea |
| SMILES | N#CC1(c2ccc(OC(F)F)c(OC(F)F)c2)CCC(NC(N)=O)CC1 |
| InChI | InChI=1S/C16H17F4N3O3/c17-13(18)25-11-2-1-9(7-12(11)26-14(19)20)16(8-21)5-3-10(4-6-16)23-15(22)24/h1-2,7,10,13-14H,3-6H2,(H3,22,23,24) |
| InChIKey | SJLPYSGPSQMDRT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea?
The IUPAC name of [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea (CID 19973131) is [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea.
What is the SMILES notation for [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea?
The canonical SMILES for [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea is N#CC1(c2ccc(OC(F)F)c(OC(F)F)c2)CCC(NC(N)=O)CC1.
What is the InChIKey of [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea?
The InChIKey is SJLPYSGPSQMDRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F4N3O3/c17-13(18)25-11-2-1-9(7-12(11)26-14(19)20)16(8-21)5-3-10(4-6-16)23-15(22)24/h1-2,7,10,13-14H,3-6H2,(H3,22,23,24).
What are the key properties of [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea?
[4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea has a molecular weight of 375.32 g/mol, XLogP of 3.26, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3,4-bis(difluoromethoxy)phenyl]-4-cyanocyclohexyl]urea is sourced from PubChem (CID 19973131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).