C22H35BrO3 — CID 19973247
tert-butyl (6E,9E,12E)-18-bromo-3-oxooctadeca-6,9,12-trienoate (PubChem CID 19973247) has the molecular formula C22H35BrO3 and a molecular weight of 427.40 g/mol. Its IUPAC name is tert-butyl (6E,9E,12E)-18-bromo-3-oxooctadeca-6,9,12-trienoate.
| Compound Name | tert-butyl (6E,9E,12E)-18-bromo-3-oxooctadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 19973247 |
| Molecular Formula | C22H35BrO3 |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | tert-butyl (6E,9E,12E)-18-bromo-3-oxooctadeca-6,9,12-trienoate |
| SMILES | CC(C)(C)OC(=O)CC(=O)CC/C=C/C/C=C/C/C=C/CCCCCBr |
| InChI | InChI=1S/C22H35BrO3/c1-22(2,3)26-21(25)19-20(24)17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-23/h5-8,11,13H,4,9-10,12,14-19H2,1-3H3/b7-5+,8-6+,13-11+ |
| InChIKey | KMUUBFARWPFBQO-JUGSPUCNSA-N |
| XLogP | 6.00 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | 470 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|