About 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine
1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine (PubChem CID 19973776) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine |
| PubChem CID | 19973776 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)C(N)C1CC2=CCC1C2 |
| InChI | InChI=1S/C12H21N/c1-12(2,3)11(13)10-7-8-4-5-9(10)6-8/h4,9-11H,5-7,13H2,1-3H3 |
| InChIKey | CXUIXLMPMTVCCK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine?
The IUPAC name of 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine (CID 19973776) is 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine.
What is the SMILES notation for 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine?
The canonical SMILES for 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine is CC(C)(C)C(N)C1CC2=CCC1C2.
What is the InChIKey of 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine?
The InChIKey is CXUIXLMPMTVCCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-12(2,3)11(13)10-7-8-4-5-9(10)6-8/h4,9-11H,5-7,13H2,1-3H3.
What are the key properties of 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine?
1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine has a molecular weight of 179.31 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bicyclo[2.2.1]hept-4-enyl)-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 19973776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).