About cyclopropene;pentane-2,4-dione
cyclopropene;pentane-2,4-dione (PubChem CID 19973815) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is cyclopropene;pentane-2,4-dione.
Molecular Properties
| Compound Name | cyclopropene;pentane-2,4-dione |
| PubChem CID | 19973815 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | cyclopropene;pentane-2,4-dione |
| SMILES | C1=CC1.CC(=O)CC(C)=O |
| InChI | InChI=1S/C5H8O2.C3H4/c1-4(6)3-5(2)7;1-2-3-1/h3H2,1-2H3;1-2H,3H2 |
| InChIKey | BCNACSDHRKRDCC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopropene;pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropene;pentane-2,4-dione?
The IUPAC name of cyclopropene;pentane-2,4-dione (CID 19973815) is cyclopropene;pentane-2,4-dione.
What is the SMILES notation for cyclopropene;pentane-2,4-dione?
The canonical SMILES for cyclopropene;pentane-2,4-dione is C1=CC1.CC(=O)CC(C)=O.
What is the InChIKey of cyclopropene;pentane-2,4-dione?
The InChIKey is BCNACSDHRKRDCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C3H4/c1-4(6)3-5(2)7;1-2-3-1/h3H2,1-2H3;1-2H,3H2.
What are the key properties of cyclopropene;pentane-2,4-dione?
cyclopropene;pentane-2,4-dione has a molecular weight of 140.18 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropene;pentane-2,4-dione is sourced from PubChem (CID 19973815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).