C9H12F6N2O3 — CID 19974025
N-(2-aminoethyl)-2,2,2-trifluoro-N-prop-2-enylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 19974025) has the molecular formula C9H12F6N2O3 and a molecular weight of 310.19 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,2,2-trifluoro-N-prop-2-enylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(2-aminoethyl)-2,2,2-trifluoro-N-prop-2-enylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 19974025 |
| Molecular Formula | C9H12F6N2O3 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-(2-aminoethyl)-2,2,2-trifluoro-N-prop-2-enylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | C=CCN(CCN)C(=O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O.C2HF3O2/c1-2-4-12(5-3-11)6(13)7(8,9)10;3-2(4,5)1(6)7/h2H,1,3-5,11H2;(H,6,7) |
| InChIKey | WRCGWSPBSRJPCI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|