C64H94F6N6O6S2 — CID 19975040
[4-[bis[4-(dibutylamino)phenyl]azaniumyl]phenyl]-bis[4-(dibutylamino)phenyl]azanium;bis(trifluoromethanesulfonate) (PubChem CID 19975040) has the molecular formula C64H94F6N6O6S2 and a molecular weight of 1221.61 g/mol. Its IUPAC name is [4-[bis[4-(dibutylamino)phenyl]azaniumyl]phenyl]-bis[4-(dibutylamino)phenyl]azanium;bis(trifluoromethanesulfonate).
| Compound Name | [4-[bis[4-(dibutylamino)phenyl]azaniumyl]phenyl]-bis[4-(dibutylamino)phenyl]azanium;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 19975040 |
| Molecular Formula | C64H94F6N6O6S2 |
| Molecular Weight | 1221.61 g/mol |
| Exact Mass | 1220.66 |
| IUPAC Name | [4-[bis[4-(dibutylamino)phenyl]azaniumyl]phenyl]-bis[4-(dibutylamino)phenyl]azanium;bis(trifluoromethanesulfonate) |
| SMILES | CCCCN(CCCC)c1ccc([NH+](c2ccc(N(CCCC)CCCC)cc2)c2ccc([NH+](c3ccc(N(CCCC)CCCC)cc3)c3ccc(N(CCCC)CCCC)cc3)cc2)cc1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C62H92N6.2CHF3O3S/c1-9-17-45-63(46-18-10-2)53-25-33-57(34-26-53)67(58-35-27-54(28-36-58)64(47-19-11-3)48-20-12-4)61-41-43-62(44-42-61)68(59-37-29-55(30-38-59)65(49-21-13-5)50-22-14-6)60-39-31-56(32-40-60)66(51-23-15-7)52-24-16-8;2*2-1(3,4)8(5,6)7/h25-44H,9-24,45-52H2,1-8H3;2*(H,5,6,7) |
| InChIKey | UXCVVGGENMCJJX-UHFFFAOYSA-N |
| XLogP | 15.78 |
| TPSA | 136.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1221.61 |
| LogP ≤ 5 | 15.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|