C16H27N3 — CID 19975076
2-benzyl-1,4,7-trimethyl-1,4,7-triazonane (PubChem CID 19975076) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-benzyl-1,4,7-trimethyl-1,4,7-triazonane.
| Compound Name | 2-benzyl-1,4,7-trimethyl-1,4,7-triazonane |
|---|---|
| PubChem CID | 19975076 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 2-benzyl-1,4,7-trimethyl-1,4,7-triazonane |
| SMILES | CN1CCN(C)CC(Cc2ccccc2)N(C)CC1 |
| InChI | InChI=1S/C16H27N3/c1-17-9-10-18(2)14-16(19(3)12-11-17)13-15-7-5-4-6-8-15/h4-8,16H,9-14H2,1-3H3 |
| InChIKey | YMZSLCSDMHLNPW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |