C18H25NO2 — CID 19975272
3-(2,4-dimethylphenyl)-5,5-dipropylpyrrolidine-2,4-dione (PubChem CID 19975272) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-5,5-dipropylpyrrolidine-2,4-dione.
| Compound Name | 3-(2,4-dimethylphenyl)-5,5-dipropylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 19975272 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-5,5-dipropylpyrrolidine-2,4-dione |
| SMILES | CCCC1(CCC)NC(=O)C(c2ccc(C)cc2C)C1=O |
| InChI | InChI=1S/C18H25NO2/c1-5-9-18(10-6-2)16(20)15(17(21)19-18)14-8-7-12(3)11-13(14)4/h7-8,11,15H,5-6,9-10H2,1-4H3,(H,19,21) |
| InChIKey | QZCWCMCFDPGPDM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|