C20H20O3S — CID 19975477
5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-ethylfuran-2-carboxylic acid (PubChem CID 19975477) has the molecular formula C20H20O3S and a molecular weight of 340.44 g/mol. Its IUPAC name is 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-ethylfuran-2-carboxylic acid.
| Compound Name | 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-ethylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 19975477 |
| Molecular Formula | C20H20O3S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-ethylfuran-2-carboxylic acid |
| SMILES | CCc1cc(C#Cc2ccc3c(c2)C(C)(C)CCS3)oc1C(=O)O |
| InChI | InChI=1S/C20H20O3S/c1-4-14-12-15(23-18(14)19(21)22)7-5-13-6-8-17-16(11-13)20(2,3)9-10-24-17/h6,8,11-12H,4,9-10H2,1-3H3,(H,21,22) |
| InChIKey | GSCXSXBHMXLTDO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|