About 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione
5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione (PubChem CID 19975807) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione.
Molecular Properties
| Compound Name | 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
| PubChem CID | 19975807 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
| SMILES | CCc1cc(=S)n2[nH]ccc2n1 |
| InChI | InChI=1S/C8H9N3S/c1-2-6-5-8(12)11-7(10-6)3-4-9-11/h3-5,9H,2H2,1H3 |
| InChIKey | MYNRUIRAMAHSEO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
The IUPAC name of 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione (CID 19975807) is 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione.
What is the SMILES notation for 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
The canonical SMILES for 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione is CCc1cc(=S)n2[nH]ccc2n1.
What is the InChIKey of 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
The InChIKey is MYNRUIRAMAHSEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S/c1-2-6-5-8(12)11-7(10-6)3-4-9-11/h3-5,9H,2H2,1H3.
What are the key properties of 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione has a molecular weight of 179.25 g/mol, XLogP of 1.95, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione is sourced from PubChem (CID 19975807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).