About 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid
3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 19976908) has the molecular formula C11H9NO3
and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 19976908 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | Cc1ccc(-c2cc(C(=O)O)on2)cc1 |
| InChI | InChI=1S/C11H9NO3/c1-7-2-4-8(5-3-7)9-6-10(11(13)14)15-12-9/h2-6H,1H3,(H,13,14) |
| InChIKey | QHISGBCCUGZEEN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid (CID 19976908) is 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid is Cc1ccc(-c2cc(C(=O)O)on2)cc1.
What is the InChIKey of 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid?
The InChIKey is QHISGBCCUGZEEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c1-7-2-4-8(5-3-7)9-6-10(11(13)14)15-12-9/h2-6H,1H3,(H,13,14).
What are the key properties of 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid?
3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid has a molecular weight of 203.20 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 19976908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).