3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid

C11H9NO3 — CID 19976908

IUPAC3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid
SMILESCc1ccc(-c2cc(C(=O)O)on2)cc1
InChIInChI=1S/C11H9NO3/c1-7-2-4-8(5-3-7)9-6-10(11(13)14)15-12-9/h2-6H,1H3,(H,13,14)
InChIKeyQHISGBCCUGZEEN-UHFFFAOYSA-N
MW203.20 g/mol
LogP2.35
Rot. Bonds2

About 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid

3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 19976908) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid
PubChem CID19976908
Molecular FormulaC11H9NO3
Molecular Weight203.20 g/mol
Exact Mass203.06
IUPAC Name3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid
SMILESCc1ccc(-c2cc(C(=O)O)on2)cc1
InChIInChI=1S/C11H9NO3/c1-7-2-4-8(5-3-7)9-6-10(11(13)14)15-12-9/h2-6H,1H3,(H,13,14)
InChIKeyQHISGBCCUGZEEN-UHFFFAOYSA-N
XLogP2.35
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.20
LogP ≤ 52.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid (CID 19976908) is 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid is Cc1ccc(-c2cc(C(=O)O)on2)cc1.
What is the InChIKey of 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid?
The InChIKey is QHISGBCCUGZEEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c1-7-2-4-8(5-3-7)9-6-10(11(13)14)15-12-9/h2-6H,1H3,(H,13,14).
What are the key properties of 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid?
3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid has a molecular weight of 203.20 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 19976908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).