5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid

C11H11NO3 — CID 19976915

IUPAC5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid
SMILESCC1(C(=O)O)C=C(c2ccccc2)NO1
InChIInChI=1S/C11H11NO3/c1-11(10(13)14)7-9(12-15-11)8-5-3-2-4-6-8/h2-7,12H,1H3,(H,13,14)
InChIKeyBUIQEANDNFEGBP-UHFFFAOYSA-N
MW205.21 g/mol
LogP1.41
Rot. Bonds2

About 5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid

5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid (PubChem CID 19976915) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid
PubChem CID19976915
Molecular FormulaC11H11NO3
Molecular Weight205.21 g/mol
Exact Mass205.07
IUPAC Name5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid
SMILESCC1(C(=O)O)C=C(c2ccccc2)NO1
InChIInChI=1S/C11H11NO3/c1-11(10(13)14)7-9(12-15-11)8-5-3-2-4-6-8/h2-7,12H,1H3,(H,13,14)
InChIKeyBUIQEANDNFEGBP-UHFFFAOYSA-N
XLogP1.41
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.21
LogP ≤ 51.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid (CID 19976915) is 5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid is CC1(C(=O)O)C=C(c2ccccc2)NO1.
What is the InChIKey of 5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid?
The InChIKey is BUIQEANDNFEGBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-11(10(13)14)7-9(12-15-11)8-5-3-2-4-6-8/h2-7,12H,1H3,(H,13,14).
What are the key properties of 5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid?
5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid has a molecular weight of 205.21 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-phenyl-2H-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 19976915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).