About 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline
4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline (PubChem CID 19977278) has the molecular formula C19H23N
and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline.
Molecular Properties
| Compound Name | 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline |
| PubChem CID | 19977278 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline |
| SMILES | C/C(=C\c1c(C)cccc1C)c1c(C)cc(N)cc1C |
| InChI | InChI=1S/C19H23N/c1-12-7-6-8-13(2)18(12)11-16(5)19-14(3)9-17(20)10-15(19)4/h6-11H,20H2,1-5H3/b16-11+ |
| InChIKey | IDDMYZVDDUZTBH-LFIBNONCSA-N |
| XLogP | 5.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline?
The IUPAC name of 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline (CID 19977278) is 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline.
What is the SMILES notation for 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline?
The canonical SMILES for 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline is C/C(=C\c1c(C)cccc1C)c1c(C)cc(N)cc1C.
What is the InChIKey of 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline?
The InChIKey is IDDMYZVDDUZTBH-LFIBNONCSA-N. The full InChI is InChI=1S/C19H23N/c1-12-7-6-8-13(2)18(12)11-16(5)19-14(3)9-17(20)10-15(19)4/h6-11H,20H2,1-5H3/b16-11+.
What are the key properties of 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline?
4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline has a molecular weight of 265.40 g/mol, XLogP of 5.06, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-1-(2,6-dimethylphenyl)prop-1-en-2-yl]-3,5-dimethylaniline is sourced from PubChem (CID 19977278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).