C11H18F2O3 — CID 19977453
1-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-difluorobut-3-en-1-ol (PubChem CID 19977453) has the molecular formula C11H18F2O3 and a molecular weight of 236.26 g/mol. Its IUPAC name is 1-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-difluorobut-3-en-1-ol.
| Compound Name | 1-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-difluorobut-3-en-1-ol |
|---|---|
| PubChem CID | 19977453 |
| Molecular Formula | C11H18F2O3 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-difluorobut-3-en-1-ol |
| SMILES | C=CC(F)(F)C(O)C1COC(CC)(CC)O1 |
| InChI | InChI=1S/C11H18F2O3/c1-4-10(5-2)15-7-8(16-10)9(14)11(12,13)6-3/h6,8-9,14H,3-5,7H2,1-2H3 |
| InChIKey | IZODNZQWVIZIAQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|