About 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate
3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate (PubChem CID 19977718) has the molecular formula C10H5ClN2O4-2
and a molecular weight of 252.61 g/mol. Its IUPAC name is 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate.
Molecular Properties
| Compound Name | 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate |
| PubChem CID | 19977718 |
| Molecular Formula | C10H5ClN2O4-2 |
| Molecular Weight | 252.61 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate |
| SMILES | Cn1cc(Cl)c2cc(C(=O)[O-])c(C(=O)[O-])nc21 |
| InChI | InChI=1S/C10H7ClN2O4/c1-13-3-6(11)4-2-5(9(14)15)7(10(16)17)12-8(4)13/h2-3H,1H3,(H,14,15)(H,16,17)/p-2 |
| InChIKey | IZMZUNOKPUPQRV-UHFFFAOYSA-L |
| XLogP | -1.05 |
| TPSA | 98.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.61 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate?
The IUPAC name of 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate (CID 19977718) is 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate.
What is the SMILES notation for 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate?
The canonical SMILES for 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate is Cn1cc(Cl)c2cc(C(=O)[O-])c(C(=O)[O-])nc21.
What is the InChIKey of 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate?
The InChIKey is IZMZUNOKPUPQRV-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H7ClN2O4/c1-13-3-6(11)4-2-5(9(14)15)7(10(16)17)12-8(4)13/h2-3H,1H3,(H,14,15)(H,16,17)/p-2.
What are the key properties of 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate?
3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate has a molecular weight of 252.61 g/mol, XLogP of -1.05, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-methylpyrrolo[2,3-b]pyridine-5,6-dicarboxylate is sourced from PubChem (CID 19977718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).