C17H22N6O2S — CID 19978053
N-methyl-2-[4-(2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperazin-1-yl]ethanesulfonamide (PubChem CID 19978053) has the molecular formula C17H22N6O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-methyl-2-[4-(2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperazin-1-yl]ethanesulfonamide.
| Compound Name | N-methyl-2-[4-(2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperazin-1-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 19978053 |
| Molecular Formula | C17H22N6O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-methyl-2-[4-(2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperazin-1-yl]ethanesulfonamide |
| SMILES | CNS(=O)(=O)CCN1CCN(c2nc3cccnc3n3cccc23)CC1 |
| InChI | InChI=1S/C17H22N6O2S/c1-18-26(24,25)13-12-21-8-10-22(11-9-21)17-15-5-3-7-23(15)16-14(20-17)4-2-6-19-16/h2-7,18H,8-13H2,1H3 |
| InChIKey | JWBOOTCNUIFNPD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |