C14H14N4 — CID 19978082
7-pyrrolidin-1-yl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 19978082) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 7-pyrrolidin-1-yl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 7-pyrrolidin-1-yl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 19978082 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 7-pyrrolidin-1-yl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | c1cnc2c(c1)nc(N1CCCC1)c1cccn12 |
| InChI | InChI=1S/C14H14N4/c1-2-9-17(8-1)14-12-6-4-10-18(12)13-11(16-14)5-3-7-15-13/h3-7,10H,1-2,8-9H2 |
| InChIKey | OQOQAWLETYVHKG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |