C12H21BrN2O — CID 19978328
1-(4-bromobutyl)-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrimidin-2-one (PubChem CID 19978328) has the molecular formula C12H21BrN2O and a molecular weight of 289.22 g/mol. Its IUPAC name is 1-(4-bromobutyl)-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrimidin-2-one.
| Compound Name | 1-(4-bromobutyl)-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrimidin-2-one |
|---|---|
| PubChem CID | 19978328 |
| Molecular Formula | C12H21BrN2O |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-(4-bromobutyl)-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrimidin-2-one |
| SMILES | O=C1CCN2CCCCC2N1CCCCBr |
| InChI | InChI=1S/C12H21BrN2O/c13-7-2-4-9-15-11-5-1-3-8-14(11)10-6-12(15)16/h11H,1-10H2 |
| InChIKey | FECDPEFXXVDWFA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|